C17H18F4N2O — CID 158336344
6-fluoro-1-methyl-7-piperidin-3-yl-2-(trifluoromethyl)-3H-indene-4-carboxamide (PubChem CID 158336344) has the molecular formula C17H18F4N2O and a molecular weight of 342.34 g/mol. Its IUPAC name is 6-fluoro-1-methyl-7-piperidin-3-yl-2-(trifluoromethyl)-3H-indene-4-carboxamide.
| Compound Name | 6-fluoro-1-methyl-7-piperidin-3-yl-2-(trifluoromethyl)-3H-indene-4-carboxamide |
|---|---|
| PubChem CID | 158336344 |
| Molecular Formula | C17H18F4N2O |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 6-fluoro-1-methyl-7-piperidin-3-yl-2-(trifluoromethyl)-3H-indene-4-carboxamide |
| SMILES | CC1=C(C(F)(F)F)Cc2c(C(N)=O)cc(F)c(C3CCCNC3)c21 |
| InChI | InChI=1S/C17H18F4N2O/c1-8-12(17(19,20)21)5-10-11(16(22)24)6-13(18)15(14(8)10)9-3-2-4-23-7-9/h6,9,23H,2-5,7H2,1H3,(H2,22,24) |
| InChIKey | GQPYSEDVNMKRFQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |