C18H18ClF2N3O2 — CID 175881292
3-chloro-5,6-difluoro-2-methyl-4-piperidin-3-yl-1-prop-2-enoylindole-7-carboxamide (PubChem CID 175881292) has the molecular formula C18H18ClF2N3O2 and a molecular weight of 381.81 g/mol. Its IUPAC name is 3-chloro-5,6-difluoro-2-methyl-4-piperidin-3-yl-1-prop-2-enoylindole-7-carboxamide.
| Compound Name | 3-chloro-5,6-difluoro-2-methyl-4-piperidin-3-yl-1-prop-2-enoylindole-7-carboxamide |
|---|---|
| PubChem CID | 175881292 |
| Molecular Formula | C18H18ClF2N3O2 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-chloro-5,6-difluoro-2-methyl-4-piperidin-3-yl-1-prop-2-enoylindole-7-carboxamide |
| SMILES | C=CC(=O)n1c(C)c(Cl)c2c(C3CCCNC3)c(F)c(F)c(C(N)=O)c21 |
| InChI | InChI=1S/C18H18ClF2N3O2/c1-3-10(25)24-8(2)14(19)12-11(9-5-4-6-23-7-9)15(20)16(21)13(17(12)24)18(22)26/h3,9,23H,1,4-7H2,2H3,(H2,22,26) |
| InChIKey | YTXMHDKKJMWBJD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|