C25H22Cl2N4O3 — CID 146475759
1-[4-[4-(6,7-dichloroindol-1-yl)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 146475759) has the molecular formula C25H22Cl2N4O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 1-[4-[4-(6,7-dichloroindol-1-yl)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(6,7-dichloroindol-1-yl)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146475759 |
| Molecular Formula | C25H22Cl2N4O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-[4-[4-(6,7-dichloroindol-1-yl)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(-n4ccc5ccc(Cl)c(Cl)c54)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C25H22Cl2N4O3/c1-3-22(32)30-9-7-16(8-10-30)34-21-12-17-19(13-20(21)33-2)28-14-29-25(17)31-11-6-15-4-5-18(26)23(27)24(15)31/h3-6,11-14,16H,1,7-10H2,2H3 |
| InChIKey | ZGVYWBFCKYISSO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|