C25H27ClN4O3 — CID 167487901
1-[4-[4-[(2-chloro-4-methylphenyl)methylamino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 167487901) has the molecular formula C25H27ClN4O3 and a molecular weight of 466.97 g/mol. Its IUPAC name is 1-[4-[4-[(2-chloro-4-methylphenyl)methylamino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[(2-chloro-4-methylphenyl)methylamino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167487901 |
| Molecular Formula | C25H27ClN4O3 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-[4-[4-[(2-chloro-4-methylphenyl)methylamino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(NCc4ccc(C)cc4Cl)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C25H27ClN4O3/c1-4-24(31)30-9-7-18(8-10-30)33-23-12-19-21(13-22(23)32-3)28-15-29-25(19)27-14-17-6-5-16(2)11-20(17)26/h4-6,11-13,15,18H,1,7-10,14H2,2-3H3,(H,27,28,29) |
| InChIKey | GKCDJQBYAGUTFJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|