C11H20N2OS — CID 176998344
ethane;N-ethyl-5-propan-2-yl-1,2-thiazole-3-carboxamide (PubChem CID 176998344) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is ethane;N-ethyl-5-propan-2-yl-1,2-thiazole-3-carboxamide.
| Compound Name | ethane;N-ethyl-5-propan-2-yl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 176998344 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | ethane;N-ethyl-5-propan-2-yl-1,2-thiazole-3-carboxamide |
| SMILES | CC.CCNC(=O)c1cc(C(C)C)sn1 |
| InChI | InChI=1S/C9H14N2OS.C2H6/c1-4-10-9(12)7-5-8(6(2)3)13-11-7;1-2/h5-6H,4H2,1-3H3,(H,10,12);1-2H3 |
| InChIKey | ZHRCLIZZSPWTRQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |