(4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen

C5H9FN2 — CID 177001376

IUPAC(4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen
SMILESN#CC1C[C@H](F)CN1.[H][H]
InChIInChI=1S/C5H7FN2.H2/c6-4-1-5(2-7)8-3-4;/h4-5,8H,1,3H2;1H/t4-,5?;/m0./s1
InChIKeyOAYKEBQXNVCAGZ-PHHGQXFYSA-N
MW116.14 g/mol
LogP0.46
Rot. Bonds

About (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen

(4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen (PubChem CID 177001376) has the molecular formula C5H9FN2 and a molecular weight of 116.14 g/mol. Its IUPAC name is (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen.

Molecular Properties

Compound Name(4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen
PubChem CID177001376
Molecular FormulaC5H9FN2
Molecular Weight116.14 g/mol
Exact Mass116.07
IUPAC Name(4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen
SMILESN#CC1C[C@H](F)CN1.[H][H]
InChIInChI=1S/C5H7FN2.H2/c6-4-1-5(2-7)8-3-4;/h4-5,8H,1,3H2;1H/t4-,5?;/m0./s1
InChIKeyOAYKEBQXNVCAGZ-PHHGQXFYSA-N
XLogP0.46
TPSA35.82 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500116.14
LogP ≤ 50.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen?
The IUPAC name of (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen (CID 177001376) is (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen.
What is the SMILES notation for (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen?
The canonical SMILES for (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen is N#CC1C[C@H](F)CN1.[H][H].
What is the InChIKey of (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen?
The InChIKey is OAYKEBQXNVCAGZ-PHHGQXFYSA-N. The full InChI is InChI=1S/C5H7FN2.H2/c6-4-1-5(2-7)8-3-4;/h4-5,8H,1,3H2;1H/t4-,5?;/m0./s1.
What are the key properties of (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen?
(4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen has a molecular weight of 116.14 g/mol, XLogP of 0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-fluoropyrrolidine-2-carbonitrile;molecular hydrogen is sourced from PubChem (CID 177001376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).