C21H19ClF3N5 — CID 177001799
3-[1-[(2S)-2-amino-5,5,5-trifluoropentyl]-5-(chloromethyl)-4-pyridin-4-ylpyrazol-3-yl]benzonitrile (PubChem CID 177001799) has the molecular formula C21H19ClF3N5 and a molecular weight of 433.87 g/mol. Its IUPAC name is 3-[1-[(2S)-2-amino-5,5,5-trifluoropentyl]-5-(chloromethyl)-4-pyridin-4-ylpyrazol-3-yl]benzonitrile.
| Compound Name | 3-[1-[(2S)-2-amino-5,5,5-trifluoropentyl]-5-(chloromethyl)-4-pyridin-4-ylpyrazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 177001799 |
| Molecular Formula | C21H19ClF3N5 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 3-[1-[(2S)-2-amino-5,5,5-trifluoropentyl]-5-(chloromethyl)-4-pyridin-4-ylpyrazol-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2nn(C[C@@H](N)CCC(F)(F)F)c(CCl)c2-c2ccncc2)c1 |
| InChI | InChI=1S/C21H19ClF3N5/c22-11-18-19(15-5-8-28-9-6-15)20(16-3-1-2-14(10-16)12-26)29-30(18)13-17(27)4-7-21(23,24)25/h1-3,5-6,8-10,17H,4,7,11,13,27H2/t17-/m0/s1 |
| InChIKey | HHYIDSARYRXPNI-KRWDZBQOSA-N |
| XLogP | 4.89 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|