C27H41N4O4+ — CID 177002204
(2Z,4Z)-3-[[2-[1-[2-(benzylamino)-2-oxoethyl]azepan-1-ium-1-yl]acetyl]amino]-N-(2-hydroxyethyl)-2,4-dimethylhexa-2,4-dienamide (PubChem CID 177002204) has the molecular formula C27H41N4O4+ and a molecular weight of 485.65 g/mol. Its IUPAC name is (2Z,4Z)-3-[[2-[1-[2-(benzylamino)-2-oxoethyl]azepan-1-ium-1-yl]acetyl]amino]-N-(2-hydroxyethyl)-2,4-dimethylhexa-2,4-dienamide.
| Compound Name | (2Z,4Z)-3-[[2-[1-[2-(benzylamino)-2-oxoethyl]azepan-1-ium-1-yl]acetyl]amino]-N-(2-hydroxyethyl)-2,4-dimethylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 177002204 |
| Molecular Formula | C27H41N4O4+ |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | (2Z,4Z)-3-[[2-[1-[2-(benzylamino)-2-oxoethyl]azepan-1-ium-1-yl]acetyl]amino]-N-(2-hydroxyethyl)-2,4-dimethylhexa-2,4-dienamide |
| SMILES | C/C=C(C)\C(NC(=O)C[N+]1(CC(=O)NCc2ccccc2)CCCCCC1)=C(/C)C(=O)NCCO |
| InChI | InChI=1S/C27H40N4O4/c1-4-21(2)26(22(3)27(35)28-14-17-32)30-25(34)20-31(15-10-5-6-11-16-31)19-24(33)29-18-23-12-8-7-9-13-23/h4,7-9,12-13,32H,5-6,10-11,14-20H2,1-3H3,(H2-,28,29,30,33,34,35)/p+1/b21-4- |
| InChIKey | YVGJTNVBVQCMDW-IGLQUIOVSA-O |
| XLogP | 2.16 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|