C27H41N6O2S+ — CID 177002121
N-benzyl-2-[1-[2-[[4-methyl-2-[N'-[3-(methylamino)propyl]carbamimidoyl]thiophen-3-yl]amino]-2-oxoethyl]azepan-1-ium-1-yl]acetamide (PubChem CID 177002121) has the molecular formula C27H41N6O2S+ and a molecular weight of 513.73 g/mol. Its IUPAC name is N-benzyl-2-[1-[2-[[4-methyl-2-[N'-[3-(methylamino)propyl]carbamimidoyl]thiophen-3-yl]amino]-2-oxoethyl]azepan-1-ium-1-yl]acetamide.
| Compound Name | N-benzyl-2-[1-[2-[[4-methyl-2-[N'-[3-(methylamino)propyl]carbamimidoyl]thiophen-3-yl]amino]-2-oxoethyl]azepan-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 177002121 |
| Molecular Formula | C27H41N6O2S+ |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | N-benzyl-2-[1-[2-[[4-methyl-2-[N'-[3-(methylamino)propyl]carbamimidoyl]thiophen-3-yl]amino]-2-oxoethyl]azepan-1-ium-1-yl]acetamide |
| SMILES | CNCCC/N=C(\N)c1scc(C)c1NC(=O)C[N+]1(CC(=O)NCc2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C27H40N6O2S/c1-21-20-36-26(27(28)30-14-10-13-29-2)25(21)32-24(35)19-33(15-8-3-4-9-16-33)18-23(34)31-17-22-11-6-5-7-12-22/h5-7,11-12,20,29H,3-4,8-10,13-19H2,1-2H3,(H3-,28,30,31,32,34,35)/p+1 |
| InChIKey | DXKBCQJOFPFPMF-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|