C27H35Cl2NO4 — CID 177003781
2-[(1S)-1-(1-adamantyl)-2-hydroxy-2-pentan-3-yloxyethyl]-4,5-dichloro-6,7-dimethylisoindole-1,3-dione (PubChem CID 177003781) has the molecular formula C27H35Cl2NO4 and a molecular weight of 508.49 g/mol. Its IUPAC name is 2-[(1S)-1-(1-adamantyl)-2-hydroxy-2-pentan-3-yloxyethyl]-4,5-dichloro-6,7-dimethylisoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-(1-adamantyl)-2-hydroxy-2-pentan-3-yloxyethyl]-4,5-dichloro-6,7-dimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 177003781 |
| Molecular Formula | C27H35Cl2NO4 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[(1S)-1-(1-adamantyl)-2-hydroxy-2-pentan-3-yloxyethyl]-4,5-dichloro-6,7-dimethylisoindole-1,3-dione |
| SMILES | CCC(CC)OC(O)[C@@H](N1C(=O)c2c(C)c(C)c(Cl)c(Cl)c2C1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H35Cl2NO4/c1-5-18(6-2)34-26(33)23(27-10-15-7-16(11-27)9-17(8-15)12-27)30-24(31)19-13(3)14(4)21(28)22(29)20(19)25(30)32/h15-18,23,26,33H,5-12H2,1-4H3/t15?,16?,17?,23-,26?,27?/m1/s1 |
| InChIKey | VDYFSRMJGWIOHW-ZLSCVHIYSA-N |
| XLogP | 6.31 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|