C20H19Cl4NO3 — CID 69251884
2-[(2S)-2-(1-adamantyl)-2-hydroxyethyl]-4,5,6,7-tetrachloroisoindole-1,3-dione (PubChem CID 69251884) has the molecular formula C20H19Cl4NO3 and a molecular weight of 463.19 g/mol. Its IUPAC name is 2-[(2S)-2-(1-adamantyl)-2-hydroxyethyl]-4,5,6,7-tetrachloroisoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-(1-adamantyl)-2-hydroxyethyl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 69251884 |
| Molecular Formula | C20H19Cl4NO3 |
| Molecular Weight | 463.19 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | 2-[(2S)-2-(1-adamantyl)-2-hydroxyethyl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1C[C@@H](O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H19Cl4NO3/c21-14-12-13(15(22)17(24)16(14)23)19(28)25(18(12)27)7-11(26)20-4-8-1-9(5-20)3-10(2-8)6-20/h8-11,26H,1-7H2/t8?,9?,10?,11-,20?/m1/s1 |
| InChIKey | ZXUAMBKLBZDFAO-KBFQAOFMSA-N |
| XLogP | 5.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.19 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|