C20H19Cl4NO4Rh2 — CID 134939839
2-[(1S)-1-(1-adamantyl)-2,2-dihydroxyethyl]-4,5,6,7-tetrachloroisoindole-1,3-dione;bis(rhodium) (PubChem CID 134939839) has the molecular formula C20H19Cl4NO4Rh2 and a molecular weight of 685.00 g/mol. Its IUPAC name is 2-[(1S)-1-(1-adamantyl)-2,2-dihydroxyethyl]-4,5,6,7-tetrachloroisoindole-1,3-dione;bis(rhodium).
| Compound Name | 2-[(1S)-1-(1-adamantyl)-2,2-dihydroxyethyl]-4,5,6,7-tetrachloroisoindole-1,3-dione;bis(rhodium) |
|---|---|
| PubChem CID | 134939839 |
| Molecular Formula | C20H19Cl4NO4Rh2 |
| Molecular Weight | 685.00 g/mol |
| Exact Mass | 682.82 |
| IUPAC Name | 2-[(1S)-1-(1-adamantyl)-2,2-dihydroxyethyl]-4,5,6,7-tetrachloroisoindole-1,3-dione;bis(rhodium) |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1[C@H](C(O)O)C12CC3CC(CC(C3)C1)C2.[Rh].[Rh] |
| InChI | InChI=1S/C20H19Cl4NO4.2Rh/c21-12-10-11(13(22)15(24)14(12)23)18(27)25(17(10)26)16(19(28)29)20-4-7-1-8(5-20)3-9(2-7)6-20;;/h7-9,16,19,28-29H,1-6H2;;/t7?,8?,9?,16-,20?;;/m1../s1 |
| InChIKey | QQTPNOHOCCPDKM-BJRCCBNXSA-N |
| XLogP | 4.79 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.00 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|