C28H33Cl2N5O3 — CID 177003884
(Z)-but-2-ene;1-[5-chloro-2-[[2-hydroxy-1-(oxolan-3-yl)ethyl]amino]-4-pyridinyl]-4-[(2-chlorophenyl)methylamino]-3-methanimidoylpyridin-2-one (PubChem CID 177003884) has the molecular formula C28H33Cl2N5O3 and a molecular weight of 558.51 g/mol. Its IUPAC name is (Z)-but-2-ene;1-[5-chloro-2-[[2-hydroxy-1-(oxolan-3-yl)ethyl]amino]-4-pyridinyl]-4-[(2-chlorophenyl)methylamino]-3-methanimidoylpyridin-2-one.
| Compound Name | (Z)-but-2-ene;1-[5-chloro-2-[[2-hydroxy-1-(oxolan-3-yl)ethyl]amino]-4-pyridinyl]-4-[(2-chlorophenyl)methylamino]-3-methanimidoylpyridin-2-one |
|---|---|
| PubChem CID | 177003884 |
| Molecular Formula | C28H33Cl2N5O3 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | (Z)-but-2-ene;1-[5-chloro-2-[[2-hydroxy-1-(oxolan-3-yl)ethyl]amino]-4-pyridinyl]-4-[(2-chlorophenyl)methylamino]-3-methanimidoylpyridin-2-one |
| SMILES | C/C=C\C.[H]/N=C/c1c(NCc2ccccc2Cl)ccn(-c2cc(NC(CO)C3CCOC3)ncc2Cl)c1=O |
| InChI | InChI=1S/C24H25Cl2N5O3.C4H8/c25-18-4-2-1-3-15(18)11-28-20-5-7-31(24(33)17(20)10-27)22-9-23(29-12-19(22)26)30-21(13-32)16-6-8-34-14-16;1-3-4-2/h1-5,7,9-10,12,16,21,27-28,32H,6,8,11,13-14H2,(H,29,30);3-4H,1-2H3/b27-10+;4-3- |
| InChIKey | SOCXZHGJVCFJOL-CWYIQRAXSA-N |
| XLogP | 5.54 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|