C9H16F3N3 — CID 177004636
methanamine;2-methyl-1-propan-2-yl-4-(trifluoromethyl)imidazole (PubChem CID 177004636) has the molecular formula C9H16F3N3 and a molecular weight of 223.24 g/mol. Its IUPAC name is methanamine;2-methyl-1-propan-2-yl-4-(trifluoromethyl)imidazole.
| Compound Name | methanamine;2-methyl-1-propan-2-yl-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 177004636 |
| Molecular Formula | C9H16F3N3 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | methanamine;2-methyl-1-propan-2-yl-4-(trifluoromethyl)imidazole |
| SMILES | CN.Cc1nc(C(F)(F)F)cn1C(C)C |
| InChI | InChI=1S/C8H11F3N2.CH5N/c1-5(2)13-4-7(8(9,10)11)12-6(13)3;1-2/h4-5H,1-3H3;2H2,1H3 |
| InChIKey | HGHJLVMBHIKWPT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |