C19H26F3N5 — CID 178172042
N-(3-aminopropyl)-N'-methyl-N-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]methanimidamide (PubChem CID 178172042) has the molecular formula C19H26F3N5 and a molecular weight of 381.45 g/mol. Its IUPAC name is N-(3-aminopropyl)-N'-methyl-N-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]methanimidamide.
| Compound Name | N-(3-aminopropyl)-N'-methyl-N-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]methanimidamide |
|---|---|
| PubChem CID | 178172042 |
| Molecular Formula | C19H26F3N5 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(3-aminopropyl)-N'-methyl-N-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]methanimidamide |
| SMILES | C/N=C/N(CCCN)Cc1ccc(-c2nc(C(F)(F)F)cn2C(C)C)cc1 |
| InChI | InChI=1S/C19H26F3N5/c1-14(2)27-12-17(19(20,21)22)25-18(27)16-7-5-15(6-8-16)11-26(13-24-3)10-4-9-23/h5-8,12-14H,4,9-11,23H2,1-3H3/b24-13+ |
| InChIKey | WBBRYZCTCYESPN-ZMOGYAJESA-N |
| XLogP | 3.96 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|