C22H27F3N4O — CID 178171952
4-morpholin-4-yl-N-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]but-2-yn-1-amine (PubChem CID 178171952) has the molecular formula C22H27F3N4O and a molecular weight of 420.48 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]but-2-yn-1-amine.
| Compound Name | 4-morpholin-4-yl-N-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 178171952 |
| Molecular Formula | C22H27F3N4O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-morpholin-4-yl-N-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]but-2-yn-1-amine |
| SMILES | CC(C)n1cc(C(F)(F)F)nc1-c1ccc(CNCC#CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27F3N4O/c1-17(2)29-16-20(22(23,24)25)27-21(29)19-7-5-18(6-8-19)15-26-9-3-4-10-28-11-13-30-14-12-28/h5-8,16-17,26H,9-15H2,1-2H3 |
| InChIKey | YUMKTYOZWYRZDQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|