C15H13F3N2O3 — CID 177004802
3,5-difluoro-4-[[4-(fluoroamino)oxyphenoxy]methyl]-N-methylbenzamide (PubChem CID 177004802) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 3,5-difluoro-4-[[4-(fluoroamino)oxyphenoxy]methyl]-N-methylbenzamide.
| Compound Name | 3,5-difluoro-4-[[4-(fluoroamino)oxyphenoxy]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 177004802 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3,5-difluoro-4-[[4-(fluoroamino)oxyphenoxy]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(F)c(COc2ccc(ONF)cc2)c(F)c1 |
| InChI | InChI=1S/C15H13F3N2O3/c1-19-15(21)9-6-13(16)12(14(17)7-9)8-22-10-2-4-11(5-3-10)23-20-18/h2-7,20H,8H2,1H3,(H,19,21) |
| InChIKey | BPIOIIDYXJZLJT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|