C24H26F3NO4 — CID 177004759
N-[4-[[2,6-difluoro-4-[(2E,4E,6E)-2-methoxy-6-methylnona-2,4,6-trien-4-yl]phenyl]methoxy]phenoxy]-N-fluorohydroxylamine (PubChem CID 177004759) has the molecular formula C24H26F3NO4 and a molecular weight of 449.47 g/mol. Its IUPAC name is N-[4-[[2,6-difluoro-4-[(2E,4E,6E)-2-methoxy-6-methylnona-2,4,6-trien-4-yl]phenyl]methoxy]phenoxy]-N-fluorohydroxylamine.
| Compound Name | N-[4-[[2,6-difluoro-4-[(2E,4E,6E)-2-methoxy-6-methylnona-2,4,6-trien-4-yl]phenyl]methoxy]phenoxy]-N-fluorohydroxylamine |
|---|---|
| PubChem CID | 177004759 |
| Molecular Formula | C24H26F3NO4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[4-[[2,6-difluoro-4-[(2E,4E,6E)-2-methoxy-6-methylnona-2,4,6-trien-4-yl]phenyl]methoxy]phenoxy]-N-fluorohydroxylamine |
| SMILES | CC/C=C(C)/C=C(\C=C(/C)OC)c1cc(F)c(COc2ccc(ON(O)F)cc2)c(F)c1 |
| InChI | InChI=1S/C24H26F3NO4/c1-5-6-16(2)11-18(12-17(3)30-4)19-13-23(25)22(24(26)14-19)15-31-20-7-9-21(10-8-20)32-28(27)29/h6-14,29H,5,15H2,1-4H3/b16-6+,17-12+,18-11+ |
| InChIKey | HAYJVPNAMCRGTB-NTLVLBLPSA-N |
| XLogP | 6.70 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|