C22H26F2N2O — CID 177004874
N-[(E)-butan-2-ylideneamino]-N-[(Z)-but-1-enyl]-3,5-difluoro-4-[(4-methylphenoxy)methyl]aniline (PubChem CID 177004874) has the molecular formula C22H26F2N2O and a molecular weight of 372.46 g/mol. Its IUPAC name is N-[(E)-butan-2-ylideneamino]-N-[(Z)-but-1-enyl]-3,5-difluoro-4-[(4-methylphenoxy)methyl]aniline.
| Compound Name | N-[(E)-butan-2-ylideneamino]-N-[(Z)-but-1-enyl]-3,5-difluoro-4-[(4-methylphenoxy)methyl]aniline |
|---|---|
| PubChem CID | 177004874 |
| Molecular Formula | C22H26F2N2O |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[(E)-butan-2-ylideneamino]-N-[(Z)-but-1-enyl]-3,5-difluoro-4-[(4-methylphenoxy)methyl]aniline |
| SMILES | CC/C=C\N(/N=C(\C)CC)c1cc(F)c(COc2ccc(C)cc2)c(F)c1 |
| InChI | InChI=1S/C22H26F2N2O/c1-5-7-12-26(25-17(4)6-2)18-13-21(23)20(22(24)14-18)15-27-19-10-8-16(3)9-11-19/h7-14H,5-6,15H2,1-4H3/b12-7-,25-17+ |
| InChIKey | AXCVNWDMMLOWHP-UQAPJURPSA-N |
| XLogP | 6.37 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|