C16H15F3N2O3 — CID 177004788
N-[4-[[4-[(ethenylamino)methyl]-2,6-difluorophenyl]methoxy]phenoxy]-N-fluorohydroxylamine (PubChem CID 177004788) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is N-[4-[[4-[(ethenylamino)methyl]-2,6-difluorophenyl]methoxy]phenoxy]-N-fluorohydroxylamine.
| Compound Name | N-[4-[[4-[(ethenylamino)methyl]-2,6-difluorophenyl]methoxy]phenoxy]-N-fluorohydroxylamine |
|---|---|
| PubChem CID | 177004788 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[4-[[4-[(ethenylamino)methyl]-2,6-difluorophenyl]methoxy]phenoxy]-N-fluorohydroxylamine |
| SMILES | C=CNCc1cc(F)c(COc2ccc(ON(O)F)cc2)c(F)c1 |
| InChI | InChI=1S/C16H15F3N2O3/c1-2-20-9-11-7-15(17)14(16(18)8-11)10-23-12-3-5-13(6-4-12)24-21(19)22/h2-8,20,22H,1,9-10H2 |
| InChIKey | AFZSRAHPNXIDBL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|