About 5-(methoxymethyl)-3,7-dimethylideneazocane
5-(methoxymethyl)-3,7-dimethylideneazocane (PubChem CID 177009605) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-(methoxymethyl)-3,7-dimethylideneazocane.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-3,7-dimethylideneazocane |
| PubChem CID | 177009605 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 5-(methoxymethyl)-3,7-dimethylideneazocane |
| SMILES | C=C1CNCC(=C)CC(COC)C1 |
| InChI | InChI=1S/C11H19NO/c1-9-4-11(8-13-3)5-10(2)7-12-6-9/h11-12H,1-2,4-8H2,3H3 |
| InChIKey | PIAMWLDQYCIHCE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(methoxymethyl)-3,7-dimethylideneazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-3,7-dimethylideneazocane?
The IUPAC name of 5-(methoxymethyl)-3,7-dimethylideneazocane (CID 177009605) is 5-(methoxymethyl)-3,7-dimethylideneazocane.
What is the SMILES notation for 5-(methoxymethyl)-3,7-dimethylideneazocane?
The canonical SMILES for 5-(methoxymethyl)-3,7-dimethylideneazocane is C=C1CNCC(=C)CC(COC)C1.
What is the InChIKey of 5-(methoxymethyl)-3,7-dimethylideneazocane?
The InChIKey is PIAMWLDQYCIHCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-9-4-11(8-13-3)5-10(2)7-12-6-9/h11-12H,1-2,4-8H2,3H3.
What are the key properties of 5-(methoxymethyl)-3,7-dimethylideneazocane?
5-(methoxymethyl)-3,7-dimethylideneazocane has a molecular weight of 181.28 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-3,7-dimethylideneazocane is sourced from PubChem (CID 177009605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).