C18H19BrClF6N3 — CID 177009748
2-bromo-3-chloro-4-(trifluoromethyl)aniline;5-butan-2-yl-4-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 177009748) has the molecular formula C18H19BrClF6N3 and a molecular weight of 506.72 g/mol. Its IUPAC name is 2-bromo-3-chloro-4-(trifluoromethyl)aniline;5-butan-2-yl-4-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 2-bromo-3-chloro-4-(trifluoromethyl)aniline;5-butan-2-yl-4-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 177009748 |
| Molecular Formula | C18H19BrClF6N3 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 2-bromo-3-chloro-4-(trifluoromethyl)aniline;5-butan-2-yl-4-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | CCC(C)c1cc(N)cc(N)c1C(F)(F)F.Nc1ccc(C(F)(F)F)c(Cl)c1Br |
| InChI | InChI=1S/C11H15F3N2.C7H4BrClF3N/c1-3-6(2)8-4-7(15)5-9(16)10(8)11(12,13)14;8-5-4(13)2-1-3(6(5)9)7(10,11)12/h4-6H,3,15-16H2,1-2H3;1-2H,13H2 |
| InChIKey | VVOMSPWAPDCKMH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|