About 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde
4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde (PubChem CID 177010482) has the molecular formula C23H45N3O2
and a molecular weight of 395.63 g/mol. Its IUPAC name is 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde.
Molecular Properties
| Compound Name | 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde |
| PubChem CID | 177010482 |
| Molecular Formula | C23H45N3O2 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.35 |
| IUPAC Name | 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde |
| SMILES | CC(C)N1CCC2(CCN(C=O)CC2)CC1.CCC1(O)CCN(C(C)C)CC1 |
| InChI | InChI=1S/C13H24N2O.C10H21NO/c1-12(2)15-9-5-13(6-10-15)3-7-14(11-16)8-4-13;1-4-10(12)5-7-11(8-6-10)9(2)3/h11-12H,3-10H2,1-2H3;9,12H,4-8H2,1-3H3 |
| InChIKey | CCRZCCIRLWDIML-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde?
The IUPAC name of 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde (CID 177010482) is 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde.
What is the SMILES notation for 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde?
The canonical SMILES for 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde is CC(C)N1CCC2(CCN(C=O)CC2)CC1.CCC1(O)CCN(C(C)C)CC1.
What is the InChIKey of 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde?
The InChIKey is CCRZCCIRLWDIML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O.C10H21NO/c1-12(2)15-9-5-13(6-10-15)3-7-14(11-16)8-4-13;1-4-10(12)5-7-11(8-6-10)9(2)3/h11-12H,3-10H2,1-2H3;9,12H,4-8H2,1-3H3.
What are the key properties of 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde?
4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde has a molecular weight of 395.63 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-propan-2-ylpiperidin-4-ol;3-propan-2-yl-3,9-diazaspiro[5.5]undecane-9-carbaldehyde is sourced from PubChem (CID 177010482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).