C25H39N3O2 — CID 177010976
2-(1-ethyl-4-hydroxypiperidin-4-yl)-1-[7-(4-propan-2-ylphenyl)-2,7-diazaspiro[3.5]nonan-2-yl]ethanone (PubChem CID 177010976) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-(1-ethyl-4-hydroxypiperidin-4-yl)-1-[7-(4-propan-2-ylphenyl)-2,7-diazaspiro[3.5]nonan-2-yl]ethanone.
| Compound Name | 2-(1-ethyl-4-hydroxypiperidin-4-yl)-1-[7-(4-propan-2-ylphenyl)-2,7-diazaspiro[3.5]nonan-2-yl]ethanone |
|---|---|
| PubChem CID | 177010976 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 2-(1-ethyl-4-hydroxypiperidin-4-yl)-1-[7-(4-propan-2-ylphenyl)-2,7-diazaspiro[3.5]nonan-2-yl]ethanone |
| SMILES | CCN1CCC(O)(CC(=O)N2CC3(CCN(c4ccc(C(C)C)cc4)CC3)C2)CC1 |
| InChI | InChI=1S/C25H39N3O2/c1-4-26-13-11-25(30,12-14-26)17-23(29)28-18-24(19-28)9-15-27(16-10-24)22-7-5-21(6-8-22)20(2)3/h5-8,20,30H,4,9-19H2,1-3H3 |
| InChIKey | YBWDQPOXNWCSBW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|