C21H25N5O — CID 177014693
5-amino-7-ethyl-3-methyl-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-6-one;aniline (PubChem CID 177014693) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 5-amino-7-ethyl-3-methyl-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-6-one;aniline.
| Compound Name | 5-amino-7-ethyl-3-methyl-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-6-one;aniline |
|---|---|
| PubChem CID | 177014693 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-amino-7-ethyl-3-methyl-1-phenyl-4,5-dihydropyrazolo[5,4-b]pyridin-6-one;aniline |
| SMILES | CCN1C(=O)C(N)Cc2c(C)nn(-c3ccccc3)c21.Nc1ccccc1 |
| InChI | InChI=1S/C15H18N4O.C6H7N/c1-3-18-14-12(9-13(16)15(18)20)10(2)17-19(14)11-7-5-4-6-8-11;7-6-4-2-1-3-5-6/h4-8,13H,3,9,16H2,1-2H3;1-5H,7H2 |
| InChIKey | BQEIWITZNZNPLX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|