C32H33ClF3N5O3 — CID 177014819
N-[2-[(3Z)-3-(1-aminoethylidene)-1-ethyl-6-oxo-2-phenyliminopiperidin-4-yl]phenyl]-2-chloropropanamide;3-(trifluoromethyl)benzamide (PubChem CID 177014819) has the molecular formula C32H33ClF3N5O3 and a molecular weight of 628.10 g/mol. Its IUPAC name is N-[2-[(3Z)-3-(1-aminoethylidene)-1-ethyl-6-oxo-2-phenyliminopiperidin-4-yl]phenyl]-2-chloropropanamide;3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(3Z)-3-(1-aminoethylidene)-1-ethyl-6-oxo-2-phenyliminopiperidin-4-yl]phenyl]-2-chloropropanamide;3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 177014819 |
| Molecular Formula | C32H33ClF3N5O3 |
| Molecular Weight | 628.10 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | N-[2-[(3Z)-3-(1-aminoethylidene)-1-ethyl-6-oxo-2-phenyliminopiperidin-4-yl]phenyl]-2-chloropropanamide;3-(trifluoromethyl)benzamide |
| SMILES | CCN1C(=O)CC(c2ccccc2NC(=O)C(C)Cl)C(=C(\C)N)/C1=N/c1ccccc1.NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H27ClN4O2.C8H6F3NO/c1-4-29-21(30)14-19(18-12-8-9-13-20(18)28-24(31)15(2)25)22(16(3)26)23(29)27-17-10-6-5-7-11-17;9-8(10,11)6-3-1-2-5(4-6)7(12)13/h5-13,15,19H,4,14,26H2,1-3H3,(H,28,31);1-4H,(H2,12,13)/b22-16-,27-23-; |
| InChIKey | JMLPDZVKBYDROK-ZUPSGIGGSA-N |
| XLogP | 6.36 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.10 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|