C14H23F3N4O5 — CID 177015465
2-[(3,4-dihydroxyoxan-2-yl)methylamino]acetaldehyde;methanol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 177015465) has the molecular formula C14H23F3N4O5 and a molecular weight of 384.36 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyoxan-2-yl)methylamino]acetaldehyde;methanol;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 2-[(3,4-dihydroxyoxan-2-yl)methylamino]acetaldehyde;methanol;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 177015465 |
| Molecular Formula | C14H23F3N4O5 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[(3,4-dihydroxyoxan-2-yl)methylamino]acetaldehyde;methanol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CO.Nc1cncc(C(F)(F)F)n1.O=CCNCC1OCCC(O)C1O |
| InChI | InChI=1S/C8H15NO4.C5H4F3N3.CH4O/c10-3-2-9-5-7-8(12)6(11)1-4-13-7;6-5(7,8)3-1-10-2-4(9)11-3;1-2/h3,6-9,11-12H,1-2,4-5H2;1-2H,(H2,9,11);2H,1H3 |
| InChIKey | WWIRJQVOTWFUKD-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 150.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|