C12H17N2Y- — CID 177015667
4,5-bis[(Z)-prop-1-enyl]-2H-pyrimidin-2-ide;ethane;yttrium (PubChem CID 177015667) has the molecular formula C12H17N2Y- and a molecular weight of 278.19 g/mol. Its IUPAC name is 4,5-bis[(Z)-prop-1-enyl]-2H-pyrimidin-2-ide;ethane;yttrium.
| Compound Name | 4,5-bis[(Z)-prop-1-enyl]-2H-pyrimidin-2-ide;ethane;yttrium |
|---|---|
| PubChem CID | 177015667 |
| Molecular Formula | C12H17N2Y- |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 4,5-bis[(Z)-prop-1-enyl]-2H-pyrimidin-2-ide;ethane;yttrium |
| SMILES | C/C=C\c1cn[c-]nc1/C=C\C.CC.[Y] |
| InChI | InChI=1S/C10H11N2.C2H6.Y/c1-3-5-9-7-11-8-12-10(9)6-4-2;1-2;/h3-7H,1-2H3;1-2H3;/q-1;;/b5-3-,6-4-;; |
| InChIKey | CJFUIJOJLWCMQK-FGDRDJDYSA-N |
| XLogP | 3.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|