C11H9N3RbW- — CID 59443306
2,5-dimethyl-6-(2H-pyridin-2-id-4-yl)-4H-pyrimidin-4-ide;rubidium(1+);tungsten (PubChem CID 59443306) has the molecular formula C11H9N3RbW- and a molecular weight of 452.52 g/mol. Its IUPAC name is 2,5-dimethyl-6-(2H-pyridin-2-id-4-yl)-4H-pyrimidin-4-ide;rubidium(1+);tungsten.
| Compound Name | 2,5-dimethyl-6-(2H-pyridin-2-id-4-yl)-4H-pyrimidin-4-ide;rubidium(1+);tungsten |
|---|---|
| PubChem CID | 59443306 |
| Molecular Formula | C11H9N3RbW- |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | 2,5-dimethyl-6-(2H-pyridin-2-id-4-yl)-4H-pyrimidin-4-ide;rubidium(1+);tungsten |
| SMILES | Cc1n[c-]c(C)c(-c2c[c-]ncc2)n1.[Rb+].[W] |
| InChI | InChI=1S/C11H9N3.Rb.W/c1-8-7-13-9(2)14-11(8)10-3-5-12-6-4-10;;/h3-5H,1-2H3;;/q-2;+1; |
| InChIKey | HACDCAZNXVJPOL-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|