C13H15N3W — CID 178007152
2,6-dimethyl-5-(3H-pyridin-3-id-4-yl)-4H-pyrimidin-4-ide;ethane;tungsten(2+) (PubChem CID 178007152) has the molecular formula C13H15N3W and a molecular weight of 397.12 g/mol. Its IUPAC name is 2,6-dimethyl-5-(3H-pyridin-3-id-4-yl)-4H-pyrimidin-4-ide;ethane;tungsten(2+).
| Compound Name | 2,6-dimethyl-5-(3H-pyridin-3-id-4-yl)-4H-pyrimidin-4-ide;ethane;tungsten(2+) |
|---|---|
| PubChem CID | 178007152 |
| Molecular Formula | C13H15N3W |
| Molecular Weight | 397.12 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2,6-dimethyl-5-(3H-pyridin-3-id-4-yl)-4H-pyrimidin-4-ide;ethane;tungsten(2+) |
| SMILES | CC.Cc1n[c-]c(-c2[c-]cncc2)c(C)n1.[W+2] |
| InChI | InChI=1S/C11H9N3.C2H6.W/c1-8-11(7-13-9(2)14-8)10-3-5-12-6-4-10;1-2;/h3,5-6H,1-2H3;1-2H3;/q-2;;+2 |
| InChIKey | GZICAPYSVORQKY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.12 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|