About 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine
5-methyl-4-methylidenepyrrolo[3,4-b]pyridine (PubChem CID 140956164) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine |
| PubChem CID | 140956164 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine |
| SMILES | C=c1ccnc2c1=C(C)N=C2 |
| InChI | InChI=1S/C9H8N2/c1-6-3-4-10-8-5-11-7(2)9(6)8/h3-5H,1H2,2H3 |
| InChIKey | TUYDHTDZIULGDS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine?
The IUPAC name of 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine (CID 140956164) is 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine.
What is the SMILES notation for 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine?
The canonical SMILES for 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine is C=c1ccnc2c1=C(C)N=C2.
What is the InChIKey of 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine?
The InChIKey is TUYDHTDZIULGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-6-3-4-10-8-5-11-7(2)9(6)8/h3-5H,1H2,2H3.
What are the key properties of 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine?
5-methyl-4-methylidenepyrrolo[3,4-b]pyridine has a molecular weight of 144.18 g/mol, XLogP of 0.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-methylidenepyrrolo[3,4-b]pyridine is sourced from PubChem (CID 140956164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).