C14H10N2 — CID 137187432
(1Z,11Z)-8,10-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 137187432) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (1Z,11Z)-8,10-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1Z,11Z)-8,10-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 137187432 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (1Z,11Z)-8,10-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C1=N\C=c2\cccc\c2=c2/cccc/c2=N/1 |
| InChI | InChI=1S/C14H10N2/c1-2-6-12-11(5-1)9-15-10-16-14-8-4-3-7-13(12)14/h1-10H/b11-9-,13-12-,15-9-,15-10-,16-10-,16-14- |
| InChIKey | PSBBPFQDJAZKFP-JVYBUECESA-N |
| XLogP | 1.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |