C29H32N6O5 — CID 177017715
3-[2-[4-hydroxy-3,3-dimethyl-1-[[3-methyl-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione (PubChem CID 177017715) has the molecular formula C29H32N6O5 and a molecular weight of 544.61 g/mol. Its IUPAC name is 3-[2-[4-hydroxy-3,3-dimethyl-1-[[3-methyl-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-[4-hydroxy-3,3-dimethyl-1-[[3-methyl-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017715 |
| Molecular Formula | C29H32N6O5 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 3-[2-[4-hydroxy-3,3-dimethyl-1-[[3-methyl-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]piperidin-4-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione |
| SMILES | Cc1cc(CN2CCC(O)(c3ccc4c(n3)CN(C3CCC(=O)NC3=O)C4=O)C(C)(C)C2)ccc1-c1ncon1 |
| InChI | InChI=1S/C29H32N6O5/c1-17-12-18(4-5-19(17)25-30-16-40-33-25)13-34-11-10-29(39,28(2,3)15-34)23-8-6-20-21(31-23)14-35(27(20)38)22-7-9-24(36)32-26(22)37/h4-6,8,12,16,22,39H,7,9-11,13-15H2,1-3H3,(H,32,36,37) |
| InChIKey | JEQFBKKMRWVKQK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|