C15H27N2P — CID 177018872
(3Z,5Z,6Z)-3-methyl-5-[1-(1-phosphanylethylideneamino)ethylidene]deca-3,6-dien-4-amine (PubChem CID 177018872) has the molecular formula C15H27N2P and a molecular weight of 266.37 g/mol. Its IUPAC name is (3Z,5Z,6Z)-3-methyl-5-[1-(1-phosphanylethylideneamino)ethylidene]deca-3,6-dien-4-amine.
| Compound Name | (3Z,5Z,6Z)-3-methyl-5-[1-(1-phosphanylethylideneamino)ethylidene]deca-3,6-dien-4-amine |
|---|---|
| PubChem CID | 177018872 |
| Molecular Formula | C15H27N2P |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (3Z,5Z,6Z)-3-methyl-5-[1-(1-phosphanylethylideneamino)ethylidene]deca-3,6-dien-4-amine |
| SMILES | CCC/C=C\C(=C(C)\N=C(/C)P)\C(N)=C(/C)CC |
| InChI | InChI=1S/C15H27N2P/c1-6-8-9-10-14(12(4)17-13(5)18)15(16)11(3)7-2/h9-10H,6-8,16,18H2,1-5H3/b10-9-,14-12-,15-11-,17-13+ |
| InChIKey | YNYLTYUQWBIDFS-HHXBMGHLSA-N |
| XLogP | 4.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|