C31H38O3 — CID 177020133
7-methyl-1-[(5E,7E)-4-phenylmethoxy-9,10-dihydrobenzo[8]annulen-5-yl]-4-propan-2-yloctane-1,2-dione (PubChem CID 177020133) has the molecular formula C31H38O3 and a molecular weight of 458.64 g/mol. Its IUPAC name is 7-methyl-1-[(5E,7E)-4-phenylmethoxy-9,10-dihydrobenzo[8]annulen-5-yl]-4-propan-2-yloctane-1,2-dione.
| Compound Name | 7-methyl-1-[(5E,7E)-4-phenylmethoxy-9,10-dihydrobenzo[8]annulen-5-yl]-4-propan-2-yloctane-1,2-dione |
|---|---|
| PubChem CID | 177020133 |
| Molecular Formula | C31H38O3 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 7-methyl-1-[(5E,7E)-4-phenylmethoxy-9,10-dihydrobenzo[8]annulen-5-yl]-4-propan-2-yloctane-1,2-dione |
| SMILES | CC(C)CCC(CC(=O)C(=O)/C1=C/C=C\CCc2cccc(OCc3ccccc3)c21)C(C)C |
| InChI | InChI=1S/C31H38O3/c1-22(2)18-19-26(23(3)4)20-28(32)31(33)27-16-10-6-9-14-25-15-11-17-29(30(25)27)34-21-24-12-7-5-8-13-24/h5-8,10-13,15-17,22-23,26H,9,14,18-21H2,1-4H3/b10-6-,27-16+ |
| InChIKey | XEPSHEBWCVXCKD-BDLNAQAPSA-N |
| XLogP | 7.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|