C22H31N4O2+ — CID 177022420
[4-[(3-ethyl-2-oxo-1H-quinolin-7-yl)methyl]piperazin-1-yl]-[(2S)-2-methylcyclopentyl]-oxoazanium (PubChem CID 177022420) has the molecular formula C22H31N4O2+ and a molecular weight of 383.52 g/mol. Its IUPAC name is [4-[(3-ethyl-2-oxo-1H-quinolin-7-yl)methyl]piperazin-1-yl]-[(2S)-2-methylcyclopentyl]-oxoazanium.
| Compound Name | [4-[(3-ethyl-2-oxo-1H-quinolin-7-yl)methyl]piperazin-1-yl]-[(2S)-2-methylcyclopentyl]-oxoazanium |
|---|---|
| PubChem CID | 177022420 |
| Molecular Formula | C22H31N4O2+ |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | [4-[(3-ethyl-2-oxo-1H-quinolin-7-yl)methyl]piperazin-1-yl]-[(2S)-2-methylcyclopentyl]-oxoazanium |
| SMILES | CCc1cc2ccc(CN3CCN([N+](=O)C4CCC[C@@H]4C)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C22H30N4O2/c1-3-18-14-19-8-7-17(13-20(19)23-22(18)27)15-24-9-11-25(12-10-24)26(28)21-6-4-5-16(21)2/h7-8,13-14,16,21H,3-6,9-12,15H2,1-2H3/p+1/t16-,21?/m0/s1 |
| InChIKey | GHKSPUINDXRKTK-BJQOMGFOSA-O |
| XLogP | 3.09 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|