C24H29N5O2 — CID 177023079
2-[(Z)-1-amino-2-(2-amino-1H-pyrrol-3-yl)ethenyl]phenol;pyridine;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 177023079) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[(Z)-1-amino-2-(2-amino-1H-pyrrol-3-yl)ethenyl]phenol;pyridine;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 2-[(Z)-1-amino-2-(2-amino-1H-pyrrol-3-yl)ethenyl]phenol;pyridine;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 177023079 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-[(Z)-1-amino-2-(2-amino-1H-pyrrol-3-yl)ethenyl]phenol;pyridine;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.N/C(=C\c1cc[nH]c1N)c1ccccc1O.c1ccncc1 |
| InChI | InChI=1S/C12H13N3O.C7H11NO.C5H5N/c13-10(7-8-5-6-15-12(8)14)9-3-1-2-4-11(9)16;1-2-7(9)8-5-3-4-6-8;1-2-4-6-5-3-1/h1-7,15-16H,13-14H2;2H,1,3-6H2;1-5H/b10-7-;; |
| InChIKey | OOTYZLHKZVKOLI-QISVCDMNSA-N |
| XLogP | 3.64 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|