C19H23ClN4O2 — CID 177023195
2-[(Z)-1-amino-2-(2-amino-4-chloro-1H-pyrrol-3-yl)ethenyl]phenol;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 177023195) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 2-[(Z)-1-amino-2-(2-amino-4-chloro-1H-pyrrol-3-yl)ethenyl]phenol;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 2-[(Z)-1-amino-2-(2-amino-4-chloro-1H-pyrrol-3-yl)ethenyl]phenol;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 177023195 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[(Z)-1-amino-2-(2-amino-4-chloro-1H-pyrrol-3-yl)ethenyl]phenol;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.N/C(=C\c1c(Cl)c[nH]c1N)c1ccccc1O |
| InChI | InChI=1S/C12H12ClN3O.C7H11NO/c13-9-6-16-12(15)8(9)5-10(14)7-3-1-2-4-11(7)17;1-2-7(9)8-5-3-4-6-8/h1-6,16-17H,14-15H2;2H,1,3-6H2/b10-5-; |
| InChIKey | VHEBBVJQDJTQKP-WIMVAJRLSA-N |
| XLogP | 3.21 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|