C16H17BrN4O2 — CID 177023261
N-[[5-amino-4-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-3-bromo-1H-pyrrol-2-yl]methyl]prop-2-enamide (PubChem CID 177023261) has the molecular formula C16H17BrN4O2 and a molecular weight of 377.24 g/mol. Its IUPAC name is N-[[5-amino-4-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-3-bromo-1H-pyrrol-2-yl]methyl]prop-2-enamide.
| Compound Name | N-[[5-amino-4-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-3-bromo-1H-pyrrol-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 177023261 |
| Molecular Formula | C16H17BrN4O2 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | N-[[5-amino-4-[(Z)-2-amino-2-(2-hydroxyphenyl)ethenyl]-3-bromo-1H-pyrrol-2-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1[nH]c(N)c(/C=C(\N)c2ccccc2O)c1Br |
| InChI | InChI=1S/C16H17BrN4O2/c1-2-14(23)20-8-12-15(17)10(16(19)21-12)7-11(18)9-5-3-4-6-13(9)22/h2-7,21-22H,1,8,18-19H2,(H,20,23)/b11-7- |
| InChIKey | VCFZFKJNDSGBQG-XFFZJAGNSA-N |
| XLogP | 2.32 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|