C17H21NO3S — CID 177025160
4-cyclohexyl-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide (PubChem CID 177025160) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-cyclohexyl-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide.
| Compound Name | 4-cyclohexyl-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide |
|---|---|
| PubChem CID | 177025160 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-cyclohexyl-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)benzamide |
| SMILES | O=C(NC1C=CS(=O)(=O)C1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H21NO3S/c19-17(18-16-10-11-22(20,21)12-16)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h6-11,13,16H,1-5,12H2,(H,18,19) |
| InChIKey | TUXIJXPIIIKYMZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |