C20H22N2O4 — CID 177025674
ethane;5-[4-(5-methylcyclohepta-1,3,6-trien-1-yl)oxyphenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 177025674) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is ethane;5-[4-(5-methylcyclohepta-1,3,6-trien-1-yl)oxyphenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | ethane;5-[4-(5-methylcyclohepta-1,3,6-trien-1-yl)oxyphenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 177025674 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | ethane;5-[4-(5-methylcyclohepta-1,3,6-trien-1-yl)oxyphenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC.CC1C=CC=C(Oc2ccc(C3C(=O)NC(=O)NC3=O)cc2)C=C1 |
| InChI | InChI=1S/C18H16N2O4.C2H6/c1-11-3-2-4-13(8-5-11)24-14-9-6-12(7-10-14)15-16(21)19-18(23)20-17(15)22;1-2/h2-11,15H,1H3,(H2,19,20,21,22,23);1-2H3 |
| InChIKey | XUXOQKWNKJGEIQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|