C21H30N2O3S — CID 177026467
4-[[3-[[(2R)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]thiane 1-oxide (PubChem CID 177026467) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is 4-[[3-[[(2R)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]thiane 1-oxide.
| Compound Name | 4-[[3-[[(2R)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]thiane 1-oxide |
|---|---|
| PubChem CID | 177026467 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 4-[[3-[[(2R)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1H-indol-5-yl]oxy]thiane 1-oxide |
| SMILES | COCCN1CCC[C@@H]1Cc1c[nH]c2ccc(OC3CCS(=O)CC3)cc12 |
| InChI | InChI=1S/C21H30N2O3S/c1-25-10-9-23-8-2-3-17(23)13-16-15-22-21-5-4-19(14-20(16)21)26-18-6-11-27(24)12-7-18/h4-5,14-15,17-18,22H,2-3,6-13H2,1H3/t17-,18?,27?/m1/s1 |
| InChIKey | YSXJNGNBQGTQFJ-ATJUXSBHSA-N |
| XLogP | 3.11 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |