C28H34N2O7 — CID 177026802
cis-(1R,2S)-2-[[4-[4-(cyclohexanecarbonylamino)phenoxy]phenyl]carbamoyl]cyclohexane-1-carboxylic acid;formic acid (PubChem CID 177026802) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[4-[4-(cyclohexanecarbonylamino)phenoxy]phenyl]carbamoyl]cyclohexane-1-carboxylic acid;formic acid.
| Compound Name | cis-(1R,2S)-2-[[4-[4-(cyclohexanecarbonylamino)phenoxy]phenyl]carbamoyl]cyclohexane-1-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 177026802 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | cis-(1R,2S)-2-[[4-[4-(cyclohexanecarbonylamino)phenoxy]phenyl]carbamoyl]cyclohexane-1-carboxylic acid;formic acid |
| SMILES | O=C(Nc1ccc(Oc2ccc(NC(=O)[C@H]3CCCC[C@H]3C(=O)O)cc2)cc1)C1CCCCC1.O=CO |
| InChI | InChI=1S/C27H32N2O5.CH2O2/c30-25(18-6-2-1-3-7-18)28-19-10-14-21(15-11-19)34-22-16-12-20(13-17-22)29-26(31)23-8-4-5-9-24(23)27(32)33;2-1-3/h10-18,23-24H,1-9H2,(H,28,30)(H,29,31)(H,32,33);1H,(H,2,3)/t23-,24+;/m0./s1 |
| InChIKey | PBAZPXULIPGKPN-KZDWWKKTSA-N |
| XLogP | 5.53 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|