C37H60N4O2 — CID 177029210
ethane;7-hexyl-1,2,3,4-tetrahydro-1,8-naphthyridine;2-(3-methylazetidin-1-yl)-2-[3-methyl-2-[C-methyl-N-(2-methylpentan-3-yl)carbonimidoyl]phenyl]acetic acid (PubChem CID 177029210) has the molecular formula C37H60N4O2 and a molecular weight of 592.91 g/mol. Its IUPAC name is ethane;7-hexyl-1,2,3,4-tetrahydro-1,8-naphthyridine;2-(3-methylazetidin-1-yl)-2-[3-methyl-2-[C-methyl-N-(2-methylpentan-3-yl)carbonimidoyl]phenyl]acetic acid.
| Compound Name | ethane;7-hexyl-1,2,3,4-tetrahydro-1,8-naphthyridine;2-(3-methylazetidin-1-yl)-2-[3-methyl-2-[C-methyl-N-(2-methylpentan-3-yl)carbonimidoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 177029210 |
| Molecular Formula | C37H60N4O2 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.47 |
| IUPAC Name | ethane;7-hexyl-1,2,3,4-tetrahydro-1,8-naphthyridine;2-(3-methylazetidin-1-yl)-2-[3-methyl-2-[C-methyl-N-(2-methylpentan-3-yl)carbonimidoyl]phenyl]acetic acid |
| SMILES | CC.CCC(/N=C(\C)c1c(C)cccc1C(C(=O)O)N1CC(C)C1)C(C)C.CCCCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C21H32N2O2.C14H22N2.C2H6/c1-7-18(13(2)3)22-16(6)19-15(5)9-8-10-17(19)20(21(24)25)23-11-14(4)12-23;1-2-3-4-5-8-13-10-9-12-7-6-11-15-14(12)16-13;1-2/h8-10,13-14,18,20H,7,11-12H2,1-6H3,(H,24,25);9-10H,2-8,11H2,1H3,(H,15,16);1-2H3/b22-16+;; |
| InChIKey | PUYHRCVZPNZEAK-LLDDCTHSSA-N |
| XLogP | 8.90 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|