C7H7BF2N4O2 — CID 177038417
[8-(difluoromethyl)-2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl]boronic acid (PubChem CID 177038417) has the molecular formula C7H7BF2N4O2 and a molecular weight of 227.97 g/mol. Its IUPAC name is [8-(difluoromethyl)-2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl]boronic acid.
| Compound Name | [8-(difluoromethyl)-2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl]boronic acid |
|---|---|
| PubChem CID | 177038417 |
| Molecular Formula | C7H7BF2N4O2 |
| Molecular Weight | 227.97 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | [8-(difluoromethyl)-2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl]boronic acid |
| SMILES | Cc1nc2c(C(F)F)cc(B(O)O)nn2n1 |
| InChI | InChI=1S/C7H7BF2N4O2/c1-3-11-7-4(6(9)10)2-5(8(15)16)13-14(7)12-3/h2,6,15-16H,1H3 |
| InChIKey | PKIRYMJDMVDRGF-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.97 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|