C19H19ClN4O2S — CID 177039831
7-(4-chlorophenyl)-5,9,11,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,12-tetraene-4-carboxylic acid (PubChem CID 177039831) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-5,9,11,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,12-tetraene-4-carboxylic acid.
| Compound Name | 7-(4-chlorophenyl)-5,9,11,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,12-tetraene-4-carboxylic acid |
|---|---|
| PubChem CID | 177039831 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 7-(4-chlorophenyl)-5,9,11,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,12-tetraene-4-carboxylic acid |
| SMILES | CC1=NN(C)C2C(C)N=C(c3ccc(Cl)cc3)c3c(sc(C(=O)O)c3C)N12 |
| InChI | InChI=1S/C19H19ClN4O2S/c1-9-14-15(12-5-7-13(20)8-6-12)21-10(2)17-23(4)22-11(3)24(17)18(14)27-16(9)19(25)26/h5-8,10,17H,1-4H3,(H,25,26) |
| InChIKey | UXZZQPRVOFNMHV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |