C23H29ClN4O2S — CID 176938175
acetaldehyde;7-(4-chlorophenyl)-4,5,11,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,12-tetraene;cyclopropanol (PubChem CID 176938175) has the molecular formula C23H29ClN4O2S and a molecular weight of 461.03 g/mol. Its IUPAC name is acetaldehyde;7-(4-chlorophenyl)-4,5,11,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,12-tetraene;cyclopropanol.
| Compound Name | acetaldehyde;7-(4-chlorophenyl)-4,5,11,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,12-tetraene;cyclopropanol |
|---|---|
| PubChem CID | 176938175 |
| Molecular Formula | C23H29ClN4O2S |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | acetaldehyde;7-(4-chlorophenyl)-4,5,11,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,12-tetraene;cyclopropanol |
| SMILES | CC1=NN(C)C2CN=C(c3ccc(Cl)cc3)c3c(sc(C)c3C)N12.CC=O.OC1CC1 |
| InChI | InChI=1S/C18H19ClN4S.C3H6O.C2H4O/c1-10-11(2)24-18-16(10)17(13-5-7-14(19)8-6-13)20-9-15-22(4)21-12(3)23(15)18;4-3-1-2-3;1-2-3/h5-8,15H,9H2,1-4H3;3-4H,1-2H2;2H,1H3 |
| InChIKey | OWSHKFLSFCSDHP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|