C17H15ClN4OS — CID 145320245
5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6-methyl-3H-thieno[2,3-e][1,4]diazepine-7-carbaldehyde (PubChem CID 145320245) has the molecular formula C17H15ClN4OS and a molecular weight of 358.85 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6-methyl-3H-thieno[2,3-e][1,4]diazepine-7-carbaldehyde.
| Compound Name | 5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6-methyl-3H-thieno[2,3-e][1,4]diazepine-7-carbaldehyde |
|---|---|
| PubChem CID | 145320245 |
| Molecular Formula | C17H15ClN4OS |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6-methyl-3H-thieno[2,3-e][1,4]diazepine-7-carbaldehyde |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(Cl)cc2)c2c1sc(C=O)c2C |
| InChI | InChI=1S/C17H15ClN4OS/c1-9-13(8-23)24-17-15(9)16(11-3-5-12(18)6-4-11)21-7-14(20)22(17)10(2)19/h3-6,8,19-20H,7H2,1-2H3/b19-10+,20-14+ |
| InChIKey | MOGBNELGAWGUFM-GNUCVDFRSA-N |
| XLogP | 4.15 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|