C20H23ClN4 — CID 155017162
1-[(2E)-5-(4-chlorophenyl)-6,7-dimethyl-2-propylidene-3,8-dihydropyrrolo[2,3-e][1,4]diazepin-1-yl]ethanimine (PubChem CID 155017162) has the molecular formula C20H23ClN4 and a molecular weight of 354.89 g/mol. Its IUPAC name is 1-[(2E)-5-(4-chlorophenyl)-6,7-dimethyl-2-propylidene-3,8-dihydropyrrolo[2,3-e][1,4]diazepin-1-yl]ethanimine.
| Compound Name | 1-[(2E)-5-(4-chlorophenyl)-6,7-dimethyl-2-propylidene-3,8-dihydropyrrolo[2,3-e][1,4]diazepin-1-yl]ethanimine |
|---|---|
| PubChem CID | 155017162 |
| Molecular Formula | C20H23ClN4 |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[(2E)-5-(4-chlorophenyl)-6,7-dimethyl-2-propylidene-3,8-dihydropyrrolo[2,3-e][1,4]diazepin-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)N1/C(=C/CC)CN=C(c2ccc(Cl)cc2)c2c1[nH]c(C)c2C |
| InChI | InChI=1S/C20H23ClN4/c1-5-6-17-11-23-19(15-7-9-16(21)10-8-15)18-12(2)13(3)24-20(18)25(17)14(4)22/h6-10,22,24H,5,11H2,1-4H3/b17-6+,22-14+ |
| InChIKey | LOSYRCCCCNSLQK-ATGGHHAUSA-N |
| XLogP | 5.23 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|