C17H16BClN4O2 — CID 162724491
[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]boronic acid (PubChem CID 162724491) has the molecular formula C17H16BClN4O2 and a molecular weight of 354.61 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]boronic acid.
| Compound Name | [5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]boronic acid |
|---|---|
| PubChem CID | 162724491 |
| Molecular Formula | C17H16BClN4O2 |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]boronic acid |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(Cl)cc2)c2cc(B(O)O)ccc21 |
| InChI | InChI=1S/C17H16BClN4O2/c1-10(20)23-15-7-4-12(18(24)25)8-14(15)17(22-9-16(23)21)11-2-5-13(19)6-3-11/h2-8,20-21,24-25H,9H2,1H3/b20-10+,21-16+ |
| InChIKey | FRSCDRJSJPQLCO-UYFDDYNLSA-N |
| XLogP | 1.65 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|